CAS 1231761-08-2
:8-Chloro-2-quinolinecarbonitrile
Description:
8-Chloro-2-quinolinecarbonitrile is a chemical compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. The presence of a chloro group at the 8-position and a cyano group at the 2-position contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. It is of interest in medicinal chemistry and material science due to its potential biological activities, including antimicrobial and anticancer properties. The cyano group can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, the chlorine atom can influence the compound's electronic properties and reactivity. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 8-Chloro-2-quinolinecarbonitrile is a valuable compound in research and development, particularly in the fields of pharmaceuticals and agrochemicals.
Formula:C10H5ClN2
InChI:InChI=1S/C10H5ClN2/c11-9-3-1-2-7-4-5-8(6-12)13-10(7)9/h1-5H
InChI key:InChIKey=DEULPCXPQZIKQZ-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C=CC(C#N)=N2)C=CC1
Synonyms:- 8-Chloro-2-quinolinecarbonitrile
- 2-Quinolinecarbonitrile, 8-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.