CAS 123180-69-8
:FMOC-ORN(BOC)-OPFP
Description:
FMOC-ORN(BOC)-OPFP, with the CAS number 123180-69-8, is a chemical compound commonly used in peptide synthesis and research. It features a combination of protective groups, specifically the FMOC (9-fluorenylmethoxycarbonyl) and BOC (tert-butyloxycarbonyl) groups, which are utilized to protect amino groups during the synthesis process. The presence of the OPFP (o-nitrophenyl phosphonyl fluoride) moiety indicates its role in facilitating the coupling of amino acids in peptide chains. This compound is typically characterized by its stability under standard laboratory conditions, making it suitable for various synthetic applications. Its structure allows for selective deprotection, enabling the release of the functional groups at specific stages of synthesis. Additionally, FMOC-ORN(BOC)-OPFP is often employed in the development of peptide-based drugs and in the study of protein interactions due to its ability to form stable linkages. As with many chemical substances, proper handling and storage are essential to maintain its integrity and effectiveness in laboratory settings.
Formula:C31H29F5N2O6
InChI:InChI=1/C31H29F5N2O6/c1-31(2,3)44-29(40)37-14-8-13-21(28(39)43-27-25(35)23(33)22(32)24(34)26(27)36)38-30(41)42-15-20-18-11-6-4-9-16(18)17-10-5-7-12-19(17)20/h4-7,9-12,20-21H,8,13-15H2,1-3H3,(H,37,40)(H,38,41)/t21-/m0/s1
SMILES:CC(C)(C)OC(=NCCC[C@@H](C(=O)Oc1c(c(c(c(c1F)F)F)F)F)N=C(O)OCC1c2ccccc2c2ccccc12)O
Synonyms:- N-Delta-Boc-N-Alpha-Fmoc-L-Ornithine Pentafluorophenyl Ester
- N-Alpha-Fmoc-N-Delta-T-Boc-L-Ornithine Pentafluorophenyl Ester
- N-Alpha-Fmoc-N-Delta-Boc-L-Ornithine Pentafluorophenyl Ester
- Fmoc-N-Delta-Boc-L-Ornithine Pentafluorophenyl Ester
- Fmoc-Ornithine(Boc)-Opfp
- N(Alpha)-Fmoc-N(Delta)-Boc-L-Ornithinepe Ntafluorophenyl E.
- Fmoc-Orn(Boc)-Opfp 96+% (Hplc)
- (2,3,4,5,6-pentafluorophenyl) (2S)-5-(tert-butoxycarbonylamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
