CAS 1231930-26-9

5-Bromo-N-cyclopentyl-2-nitrobenzenamine

Description:

5-Bromo-N-cyclopentyl-2-nitrobenzenamine is an organic compound characterized by the presence of a bromine atom, a nitro group, and an amine functional group attached to a benzene ring. The compound features a cyclopentyl group, which contributes to its unique structural properties and potential reactivity. The bromine substituent typically enhances the compound's electrophilic character, making it useful in various chemical reactions, such as nucleophilic substitutions. The nitro group is known for its electron-withdrawing properties, which can influence the compound's reactivity and stability. This compound may exhibit moderate to high solubility in organic solvents, depending on the specific conditions and the presence of other functional groups. Its potential applications could span across pharmaceuticals, agrochemicals, or materials science, where the specific interactions of the bromine, nitro, and amine groups can be exploited. Safety and handling considerations are essential, as compounds containing bromine and nitro groups can pose health risks and environmental concerns.

Formula: C₁₁H₁₃BrN₂O₂

InChI: InChI=1S/C11H13BrN2O2/c12-8-5-6-11(14(15)16)10(7-8)13-9-3-1-2-4-9/h5-7,9,13H,1-4H2

InChI key: InChIKey=CWXSDTYCVIABLU-UHFFFAOYSA-N

SMILES: N(C1=C(N(=O)=O)C=CC(Br)=C1)C2CCCC2

Synonyms:

• Benzenamine, 5-bromo-N-cyclopentyl-2-nitro-
• 5-Bromo-N-cyclopentyl-2-nitrobenzenamine
• 5-Bromo-N-cyclopentyl-2-nitroaniline