CAS 1231930-33-8
:6-Bromo-4-fluoro-2-methyl-1-(1-methylethyl)-1H-benzimidazole
Description:
6-Bromo-4-fluoro-2-methyl-1-(1-methylethyl)-1H-benzimidazole is a chemical compound characterized by its complex structure, which includes a benzimidazole core substituted with various functional groups. The presence of bromine and fluorine atoms introduces significant electronegativity and can influence the compound's reactivity and interaction with biological systems. The methyl and isopropyl groups contribute to its hydrophobic character, potentially affecting its solubility and permeability in biological membranes. This compound may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its unique combination of halogen and alkyl substituents can lead to diverse applications, particularly in the development of pharmaceuticals or agrochemicals. The specific arrangement of atoms and the presence of heteroatoms in the benzimidazole ring can also impact its electronic properties, making it a subject of interest for further studies in organic synthesis and material science. Overall, 6-Bromo-4-fluoro-2-methyl-1-(1-methylethyl)-1H-benzimidazole represents a versatile structure with potential implications in various chemical and biological fields.
Formula:C11H12BrFN2
InChI:InChI=1S/C11H12BrFN2/c1-6(2)15-7(3)14-11-9(13)4-8(12)5-10(11)15/h4-6H,1-3H3
InChI key:InChIKey=SJQZRZLUEGCXFN-UHFFFAOYSA-N
SMILES:C(C)(C)N1C=2C(=C(F)C=C(Br)C2)N=C1C
Synonyms:- 6-Bromo-4-fluoro-2-methyl-1-(1-methylethyl)-1H-benzimidazole
- 1H-Benzimidazole, 6-bromo-4-fluoro-2-methyl-1-(1-methylethyl)-
- 6-Bromo-4-fluoro-1-isopropyl-2-methyl-1H-benzo[d]imidazole
- Abemaciclib Impurity 1
- 6-bromo-4-fluoro-2-methyl-1-(propan-2-yl)-1H-1,3-benzodiazole
- 6-bromo-4-fluoro-2-methyl-1-propan-2-ylbenzimidazole
- 6-Bromo-4-fluoro-1-isopropyl-2-methyl-1H-benzo[d]imidazole ISO 9001:2015 REACH
- 6-Bromo-4-fluoro-1-isopropyl-2-methylbenzimidazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1H-Benzimidazole, 6-bromo-4-fluoro-2-methyl-1-(1-methylethyl)-
CAS:Formula:C11H12BrFN2Purity:98%Color and Shape:SolidMolecular weight:271.12886-Bromo-4-fluoro-1-isopropyl-2-methyl-benzimidazole
CAS:<p>6-Bromo-4-fluoro-1-isopropyl-2-methyl-benzimidazole</p>Purity:98%Molecular weight:271.13g/mol6-Bromo-4-fluoro-2-methyl-1-propan-2-ylbenzimidazole
CAS:<p>6-Bromo-4-fluoro-2-methyl-1-propan-2-ylbenzimidazole is an environmental pollutant that can be found in deionized water, as a result of the reaction between hydrochloric acid and benzene. It has been synthesized using the industrial synthesis method by reacting n-hexane with sodium sulfate, followed by treatment with acetone and hydriodic acid. 6BFMBI is a white solid that reacts with hydrogen to produce acetone and formaldehyde. The reaction time for this compound is about three hours at room temperature.</p>Formula:C11H12BrFN2Purity:Min. 95%Color and Shape:PowderMolecular weight:271.13 g/mol6-Bromo-4-fluoro-1-isopropyl-2-methyl-1H-benzo[d]imidazole
CAS:Formula:C11H12BrFN2Purity:98%Molecular weight:271.133




