CAS 123198-82-3
:Poly(o-aminothiophenol)
Description:
Poly(o-aminothiophenol) is a conducting polymer characterized by its unique structure, which consists of repeating units of o-aminothiophenol. This polymer exhibits notable electrical conductivity, making it suitable for various electronic applications, including sensors and organic electronics. Its chemical structure features amino and thiol functional groups, which contribute to its reactivity and ability to form hydrogen bonds, enhancing its stability and solubility in certain solvents. Poly(o-aminothiophenol) also demonstrates good thermal stability and can undergo oxidation, which allows for the formation of conductive films. Additionally, it has potential applications in the fields of biotechnology and materials science due to its biocompatibility and ability to interact with biological molecules. The polymer's properties can be further modified through chemical doping or blending with other materials, enabling tailored functionalities for specific applications. Overall, Poly(o-aminothiophenol) is a versatile material with promising characteristics for advancing technology in various domains.
Formula:(C6H7NS)x
InChI:InChI=1S/C6H7NS/c7-5-3-1-2-4-6(5)8/h1-4,8H,7H2
InChI key:InChIKey=VRVRGVPWCUEOGV-UHFFFAOYSA-N
SMILES:NC1=C(S)C=CC=C1
Synonyms:- Benzenethiol, 2-amino-, homopolymer
- Poly(2-mercaptoaniline)
- Poly(o-mercaptoaniline)
- Poly(o-thioaniline)
- Poly(o-aminothiophenol)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
