CAS 1232-80-0
:2-hydroxyestriol
Description:
2-Hydroxyestriol, also known as 2-hydroxy-17β-estradiol, is a naturally occurring estrogen and a metabolite of estriol. It is characterized by its hydroxyl (-OH) functional groups, which are positioned at the 2 and 17β positions of the estrane steroid backbone. This compound plays a role in various biological processes, including the regulation of reproductive functions and the modulation of estrogen receptor activity. 2-Hydroxyestriol is often studied for its potential protective effects against certain hormone-related cancers, as it may exhibit weaker estrogenic activity compared to other estrogens. Its chemical structure contributes to its solubility and reactivity, making it relevant in both pharmacological and biochemical research. The substance is typically found in low concentrations in biological fluids and can be synthesized or extracted for analytical purposes. As a compound with a CAS number of 1232-80-0, it is recognized in chemical databases and is subject to various regulatory considerations in research and therapeutic applications.
Formula:C18H24O4
InChI:InChI=1/C18H24O4/c1-18-5-4-10-11(13(18)8-16(21)17(18)22)3-2-9-6-14(19)15(20)7-12(9)10/h6-7,10-11,13,16-17,19-22H,2-5,8H2,1H3/t10-,11+,13-,16+,17-,18-/m0/s1
Synonyms:- Estra-1,3,5(10)-triene-2,3,16alpha,17beta-tetrol
- (16Alpha)-Estra-1(10),2,4-Triene-2,3,16,17-Tetrol
- (16Alpha,17Beta)-Estra-1(10),2,4-Triene-2,3,16,17-Tetrol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Hydroxyestriol
CAS:Applications 2-Hydroxyestriol is used to characterize oxidative metabolites of 17β-estradiol and estrone formed by 15 selectively expressed human cytochrome P 450 isoforms.
References Lee, A., et al.: Endocrinol., 144, 3382 (2003);Formula:C18H24O4Color and Shape:NeatMolecular weight:304.38
