CymitQuimica logo

CAS 1232060-85-3

:

3-Amino-1,5-anhydro-3,4-dideoxy-2-O-methyl-D-erythro-pentitol

Description:
3-Amino-1,5-anhydro-3,4-dideoxy-2-O-methyl-D-erythro-pentitol is a chemical compound characterized by its unique structural features, which include an amino group and a methoxy group, contributing to its reactivity and potential biological activity. This compound belongs to the class of sugar alcohols and is derived from pentose sugars, specifically exhibiting modifications that alter its typical properties. The presence of the amino group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or as a biochemical probe. Its anhydro and dideoxy characteristics indicate that it may participate in specific biochemical pathways or interactions, making it of interest in research related to carbohydrate chemistry and glycoscience. The methoxy group can influence solubility and stability, which are critical factors in drug design. Overall, this compound's structural complexity and functional groups position it as a valuable subject for further investigation in both synthetic and applied chemistry contexts.
Formula:C6H13NO2
InChI:InChI=1S/C6H13NO2/c1-8-6-4-9-3-2-5(6)7/h5-6H,2-4,7H2,1H3/t5-,6+/m1/s1
InChI key:InChIKey=OHVYRLNUMZHWIK-RITPCOANSA-N
SMILES:O(C)[C@@H]1[C@H](N)CCOC1
Synonyms:
  • 3-Amino-1,5-anhydro-3,4-dideoxy-2-O-methyl-D-erythro-pentitol
  • D-erythro-Pentitol, 3-amino-1,5-anhydro-3,4-dideoxy-2-O-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.