CAS 12321-44-7
:thyrocalcitonin porcine
Description:
Thyrocalcitonin porcine, also known as calcitonin, is a peptide hormone produced by the parafollicular cells (C cells) of the thyroid gland in pigs. It plays a crucial role in calcium homeostasis by lowering blood calcium levels, primarily through inhibiting osteoclast activity in bones and reducing renal tubular reabsorption of calcium. This hormone is composed of a chain of amino acids and exhibits a specific three-dimensional structure essential for its biological activity. Thyrocalcitonin porcine is often used in clinical settings for the treatment of conditions such as osteoporosis and Paget's disease, as it helps to counteract bone resorption. The substance is characterized by its relatively short half-life in circulation, necessitating careful dosing and administration. It is typically administered via injection due to its peptide nature, which limits its oral bioavailability. Additionally, the porcine form is of particular interest due to its structural similarity to human calcitonin, making it a valuable model for research and therapeutic applications.
Formula:C159H232N46O45S3
InChI:InChI=1/C159H234N46O45S3/c1-77(2)52-98(185-146(239)107(61-118(161)213)191-136(229)95(37-25-48-172-159(168)169)181-144(237)105(59-88-65-173-93-35-23-22-34-91(88)93)189-141(234)102(58-87-40-42-90(212)43-41-87)184-130(223)81(9)178-150(243)112(71-207)198-140(233)100(54-79(5)6)195-155(248)126(80(7)8)201-153(246)115(75-252)200-156(249)127(82(10)210)202-152(245)114(73-209)199-139(232)99(53-78(3)4)186-147(240)110(64-121(164)216)194-151(244)113(72-208)196-131(224)92(160)74-251)138(231)192-109(63-120(163)215)149(242)193-108(62-119(162)214)148(241)188-103(56-85-30-18-14-19-31-85)142(235)190-106(60-89-66-170-76-177-89)145(238)182-94(36-24-47-171-158(166)167)135(228)187-104(57-86-32-20-15-21-33-86)143(236)197-111(70-206)134(227)175-67-122(217)179-97(46-51-253-12)132(225)174-68-123(218)180-101(55-84-28-16-13-17-29-84)133(226)176-69-124(219)204-49-27-39-117(204)154(247)183-96(44-45-125(220)221)137(230)203-128(83(11)211)157(250)205-50-26-38-116(205)129(165)222/h13-23,28-35,40-43,65-66,76-83,92,94-117,126-128,173,206-212,251-252H,24-27,36-39,44-64,67-75,160H2,1-12H3,(H2,161,213)(H2,162,214)(H2,163,215)(H2,164,216)(H2,165,222)(H,170,177)(H,174,225)(H,175,227)(H,176,226)(H,178,243)(H,179,217)(H,180,218)(H,181,237)(H,182,238)(H,183,247)(H,184,223)(H,185,239)(H,186,240)(H,187,228)(H,188,241)(H,189,234)(H,190,235)(H,191,229)(H,192,231)(H,193,242)(H,194,244)(H,195,248)(H,196,224)(H,197,236)(H,198,233)(H,199,232)(H,200,249)(H,201,246)(H,202,245)(H,203,230)(H,220,221)(H4,166,167,171)(H4,168,169,172)/t81-,82+,83+,92-,94-,95-,96-,97-,98-,99-,100-,101-,102-,103-,104-,105-,106-,107-,108-,109-,110-,111-,112-,113-,114-,115-,116-,117-,126-,127-,128-/m0/s1
Synonyms:- Calcitonin (porcine)
- H-Cys-Ser-Asn-Leu-Ser-Thr-Cys-Val-Leu-Ser-Ala-Tyr-Trp-Arg-Asn-Leu-Asn-Asn-Phe-His-Arg-Phe-Ser-Gly-Met-Gly-Phe-Gly-Pro-Glu-Thr-Pro-NH2 (Disulfide bond)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
L-Prolinamide, L-cysteinyl-L-seryl-L-asparaginyl-L-leucyl-L-seryl-L-threonyl-L-cysteinyl-L-valyl-L-leucyl-L-seryl-L-alanyl-L-tyrosyl-L-tryptophyl-L-arginyl-L-asparaginyl-L-leucyl-L-asparaginyl-L-asparaginyl-L-phenylalanyl-L-histidyl-L-arginyl-L-phenylalanyl-L-serylglycyl-L-methionylglycyl-L-phenylalanylglycyl-L-prolyl-L-α-glutamyl-L-threonyl-, cyclic (1→7)-disulfide
CAS:Formula:C159H232N46O45S3Molecular weight:3604.0196Calcitonin (porcine)
CAS:Calcitonin is a hormone that is used to treat low calcium levels in the blood. It is a peptide hormone secreted by the thyroid gland and released into the bloodstream when calcium levels are too high. Calcitonin lowers blood calcium levels by inhibiting the release of calcium from bone tissue, which decreases the amount of calcium in the blood.Formula:C159H232N46O45S3Purity:Min. 95%Molecular weight:3,604.02 g/molPorcine calcitonin trifluroacetate
CAS:Please enquire for more information about Porcine calcitonin trifluroacetate including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C159H232N46O45S3•(C2HF3O2)4Purity:Min. 95%Molecular weight:4,060.09 g/mol


