CAS 1232133-69-5

4-Bromo-2-hydrazinylbenzoic acid

Description:

4-Bromo-2-hydrazinylbenzoic acid is an organic compound characterized by the presence of a bromine atom, a hydrazine functional group, and a carboxylic acid moiety attached to a benzene ring. Its molecular structure features a bromobenzene core, where the bromine substituent is located at the para position relative to the hydrazinyl group, which is attached at the ortho position to the carboxylic acid. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The hydrazinyl group can participate in various chemical reactions, making this compound of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the presence of the bromine atom can enhance the compound's reactivity and influence its biological activity. As with many hydrazine derivatives, care should be taken when handling this compound due to potential toxicity and reactivity.

Formula: C₇H₇BrN₂O₂

InChI: InChI=1S/C7H7BrN2O2/c8-4-1-2-5(7(11)12)6(3-4)10-9/h1-3,10H,9H2,(H,11,12)

InChI key: InChIKey=DRQGPUIZIISGCM-UHFFFAOYSA-N

SMILES: N(N)C1=C(C(O)=O)C=CC(Br)=C1

Synonyms:

• Benzoic acid, 4-bromo-2-hydrazinyl-
• 4-Bromo-2-hydrazinylbenzoic acid