CAS 1232407-69-0

6-Bromo-2,3-difluoro-α-methylbenzenemethanol

Description:

6-Bromo-2,3-difluoro-α-methylbenzenemethanol is an organic compound characterized by its complex structure, which includes a bromine atom and two fluorine atoms attached to a benzene ring, along with a hydroxymethyl group. The presence of the bromine and fluorine substituents contributes to its unique reactivity and potential applications in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The α-methyl group enhances the steric hindrance around the aromatic system, influencing its chemical behavior and interactions. This compound may exhibit interesting properties such as solubility in organic solvents and potential biological activity, making it of interest in medicinal chemistry and material science. Its specific melting point, boiling point, and other physical properties would depend on the molecular interactions and the overall stability of the compound. As with many halogenated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns.

Formula: C₈H₇BrF₂O

InChI: InChI=1S/C8H7BrF2O/c1-4(12)7-5(9)2-3-6(10)8(7)11/h2-4,12H,1H3

InChI key: InChIKey=BPGWNXPISPXEJE-UHFFFAOYSA-N

SMILES: C(C)(O)C1=C(F)C(F)=CC=C1Br

Synonyms:

• 1-(6-Bromo-2,3-difluorophenyl)ethan-1-ol
• Benzenemethanol, 6-bromo-2,3-difluoro-α-methyl-
• 1-(6-Bromo-2,3-difluorophenyl)ethanol
• 6-Bromo-2,3-difluoro-α-methylbenzenemethanol