CAS 123241-42-9

2-Amino-6-ethoxybenzonitrile

Description:

2-Amino-6-ethoxybenzonitrile is an organic compound characterized by the presence of an amino group (-NH2), an ethoxy group (-OCH2CH3), and a nitrile group (-C≡N) attached to a benzene ring. This compound features a benzene ring substituted at the 2 and 6 positions, which influences its chemical reactivity and physical properties. The amino group can participate in hydrogen bonding, enhancing its solubility in polar solvents, while the ethoxy group contributes to its overall hydrophobic character. The nitrile group is known for its ability to stabilize negative charges and can participate in various chemical reactions, including nucleophilic additions. 2-Amino-6-ethoxybenzonitrile may exhibit biological activity, making it of interest in pharmaceutical research. Its synthesis typically involves the introduction of the amino and ethoxy groups onto the benzene ring, followed by nitrile formation. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled.

Formula: C₉H₁₀N₂O

InChI: InChI=1S/C9H10N2O/c1-2-12-9-5-3-4-8(11)7(9)6-10/h3-5H,2,11H2,1H3

InChI key: InChIKey=OREORIYCUIWBGD-UHFFFAOYSA-N

SMILES: O(CC)C1=C(C#N)C(N)=CC=C1

Synonyms:

• Benzonitrile, 2-amino-6-ethoxy-
• 2-Amino-6-ethoxybenzonitrile