CymitQuimica logo

CAS 1232431-15-0

:

3-Chloro-2,4-pyridinediamine

Description:
3-Chloro-2,4-pyridinediamine, identified by its CAS number 1232431-15-0, is an organic compound featuring a pyridine ring substituted with two amino groups and a chlorine atom. This compound typically exhibits characteristics common to pyridine derivatives, such as being a solid at room temperature and possessing a distinct aromatic odor. The presence of amino groups contributes to its basicity and potential reactivity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The chlorine atom introduces additional reactivity, making it a useful intermediate in the synthesis of pharmaceuticals and agrochemicals. Its solubility in polar solvents, such as water and alcohols, is influenced by the amino groups, which can engage in hydrogen bonding. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 3-Chloro-2,4-pyridinediamine is a valuable compound in organic synthesis and medicinal chemistry, with potential applications in developing new therapeutic agents.
Formula:C5H6ClN3
InChI:InChI=1S/C5H6ClN3/c6-4-3(7)1-2-9-5(4)8/h1-2H,(H4,7,8,9)
InChI key:InChIKey=LMXQZFLWOADSEQ-UHFFFAOYSA-N
SMILES:ClC=1C(N)=CC=NC1N
Synonyms:
  • 2,4-Pyridinediamine, 3-chloro-
  • 3-Chloro-2,4-pyridinediamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.