CAS 1232431-75-2

4-Bromo-2,3-pyridinediamine

Description:

4-Bromo-2,3-pyridinediamine, with the CAS number 1232431-75-2, is an organic compound characterized by the presence of a bromine atom and two amino groups attached to a pyridine ring. This compound features a six-membered aromatic ring containing nitrogen, which contributes to its basicity and potential reactivity. The bromine substituent enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. The amino groups can participate in hydrogen bonding, influencing its solubility and interaction with biological systems. Typically, compounds like 4-Bromo-2,3-pyridinediamine are of interest in medicinal chemistry and materials science due to their potential applications in drug development and as intermediates in organic synthesis. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Safety data should be consulted to understand its handling and potential hazards, as with any chemical substance.

Formula: C₅H₆BrN₃

InChI: InChI=1S/C5H6BrN3/c6-3-1-2-9-5(8)4(3)7/h1-2H,7H2,(H2,8,9)

SMILES: c1c[nH]c(=N)c(c1Br)N

Synonyms:

• 2,3-Diamino-4-bromopyridine

2,3-Pyridinediamine, 4-bromo-

CAS: 1232431-75-2

Formula: C₅H₆BrN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 188.0252

Ref: IN-DA000K7T

4-Bromopyridine-2,3-diamine

CAS: 1232431-75-2

4-Bromopyridine-2,3-diamine

Formula: C₅H₆BrN₃

Purity: 97%

Color and Shape: grey/purple/brown powder

Molecular weight: 188.03g/mol

Ref: 54-OR71122

2,3-Diamino-4-bromopyridine

CAS: 1232431-75-2

Purity: 95%

Molecular weight: 188.025

Ref: FT-D13409

4-Bromopyridine-2,3-diamine

CAS: 1232431-75-2

Formula: C₅H₆BrN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 188.028

Ref: 10-F233639

4-Bromopyridine-2,3-diamine

CAS: 1232431-75-2

Versatile small molecule scaffold

Formula: C₅H₆N₃Br

Purity: Min. 95%

Molecular weight: 188.02 g/mol

Ref: 3D-HZB43175