CAS 1232432-48-2

Ethyl 2-nitro-4-pyridinecarboxylate

Description:

Ethyl 2-nitro-4-pyridinecarboxylate is an organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a nitro group (-NO2) and an ethyl ester functional group, contributing to its reactivity and solubility properties. Typically, it appears as a yellow to brown solid or liquid, depending on its purity and specific conditions. Ethyl 2-nitro-4-pyridinecarboxylate is known for its applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. The presence of the nitro group enhances its electrophilic character, making it a useful intermediate in synthetic pathways. Additionally, this compound may exhibit biological activity, which can be explored in medicinal chemistry. As with many nitro compounds, it is important to handle it with care due to potential toxicity and environmental concerns.

Formula: C₈H₈N₂O₄

InChI: InChI=1S/C8H8N2O4/c1-2-14-8(11)6-3-4-9-7(5-6)10(12)13/h3-5H,2H2,1H3

InChI key: InChIKey=MLSHUWPJJAKBOJ-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C=C(N(=O)=O)N=CC1

Synonyms:

• 4-Pyridinecarboxylic acid, 2-nitro-, ethyl ester
• Ethyl 2-nitro-4-pyridinecarboxylate