CAS 1232774-18-3
:3-Chloro-2-ethyl-4-fluorophenol
Description:
3-Chloro-2-ethyl-4-fluorophenol is an organic compound characterized by its aromatic structure, which includes a phenolic group. This compound features a chlorine atom and a fluorine atom substituted on the benzene ring, along with an ethyl group at the second position relative to the hydroxyl group. The presence of these halogen substituents can significantly influence the compound's chemical reactivity, polarity, and biological activity. Typically, compounds like this may exhibit properties such as moderate solubility in organic solvents and limited solubility in water due to the hydrophobic ethyl group and the polar hydroxyl group. The compound may also demonstrate potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Safety data sheets would indicate handling precautions due to potential toxicity or environmental impact, as halogenated phenols can be hazardous. Overall, 3-Chloro-2-ethyl-4-fluorophenol is a compound of interest in various chemical research fields, particularly in the study of structure-activity relationships in medicinal chemistry.
Formula:C8H8ClFO
InChI:InChI=1S/C8H8ClFO/c1-2-5-7(11)4-3-6(10)8(5)9/h3-4,11H,2H2,1H3
InChI key:InChIKey=DKURNKZMXNLSLP-UHFFFAOYSA-N
SMILES:C(C)C1=C(Cl)C(F)=CC=C1O
Synonyms:- Phenol, 3-chloro-2-ethyl-4-fluoro-
- 3-Chloro-2-ethyl-4-fluorophenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
