CAS 1232815-51-8
:7-Bromo-4-chloro-2-(methylthio)pyrrolo[2,1-f][1,2,4]triazine
Description:
7-Bromo-4-chloro-2-(methylthio)pyrrolo[2,1-f][1,2,4]triazine is a heterocyclic compound characterized by its complex ring structure, which incorporates both triazine and pyrrole moieties. The presence of bromine and chlorine substituents contributes to its reactivity and potential applications in various chemical reactions. The methylthio group enhances its solubility and may influence its biological activity. This compound is of interest in medicinal chemistry and material science due to its potential as a building block for pharmaceuticals or agrochemicals. Its unique structure may also exhibit interesting electronic properties, making it suitable for research in organic electronics or photonic applications. The compound's stability, solubility, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many heterocycles, it may participate in diverse chemical reactions, including nucleophilic substitutions and cycloadditions, which can be exploited in synthetic pathways. Safety and handling precautions should be observed due to the presence of halogenated substituents, which may pose health and environmental risks.
Formula:C7H5BrClN3S
InChI:InChI=1S/C7H5BrClN3S/c1-13-7-10-6(9)4-2-3-5(8)12(4)11-7/h2-3H,1H3
InChI key:InChIKey=XDTZPGFYRDCGAZ-UHFFFAOYSA-N
SMILES:BrC=1N2C(C(Cl)=NC(SC)=N2)=CC1
Synonyms:- 7-Bromo-4-chloro-2-(methylthio)pyrrolo[2,1-f][1,2,4]triazine
- Pyrrolo[2,1-f][1,2,4]triazine, 7-bromo-4-chloro-2-(methylthio)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.