
CAS 1232837-27-2
:5-Cyclopropyl-4-ethyl-1H-pyrazol-3-amine
Description:
5-Cyclopropyl-4-ethyl-1H-pyrazol-3-amine is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a cyclopropyl group and an ethyl group contributes to its unique properties and potential biological activity. This compound may exhibit various characteristics such as solubility in organic solvents, depending on its functional groups and substituents. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. The amine functional group indicates that it can participate in hydrogen bonding, which may influence its reactivity and interaction with other molecules. Additionally, the compound's specific stereochemistry and electronic properties can affect its pharmacokinetics and pharmacodynamics. Overall, 5-Cyclopropyl-4-ethyl-1H-pyrazol-3-amine represents a class of compounds that may have applications in pharmaceuticals, particularly in the development of new therapeutic agents.
Formula:C8H13N3
InChI:InChI=1S/C8H13N3/c1-2-6-7(5-3-4-5)10-11-8(6)9/h5H,2-4H2,1H3,(H3,9,10,11)
InChI key:InChIKey=JAYIFKFSOAFCCS-UHFFFAOYSA-N
SMILES:C(C)C1=C(NN=C1N)C2CC2
Synonyms:- 1H-Pyrazol-3-amine, 5-cyclopropyl-4-ethyl-
- 5-Cyclopropyl-4-ethyl-1H-pyrazol-3-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.