CAS 123293-66-3
:Ethyl (2E)-3-(3-thienyl)-2-propenoate
Description:
Ethyl (2E)-3-(3-thienyl)-2-propenoate, with the CAS number 123293-66-3, is an organic compound characterized by its ester functional group and a conjugated double bond system. This compound features a thienyl group, which is a five-membered aromatic ring containing sulfur, contributing to its unique chemical properties and potential reactivity. The presence of the ethyl ester group enhances its solubility in organic solvents, making it suitable for various applications in organic synthesis and potentially in the development of pharmaceuticals or agrochemicals. The (2E) configuration indicates the specific geometric arrangement of the double bond, which can influence the compound's reactivity and interaction with biological systems. Ethyl (2E)-3-(3-thienyl)-2-propenoate may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry. As with many organic compounds, its stability, reactivity, and potential applications can be influenced by environmental factors such as temperature and pH.
Formula:C9H10O2S
InChI:InChI=1S/C9H10O2S/c1-2-11-9(10)4-3-8-5-6-12-7-8/h3-7H,2H2,1H3/b4-3+
InChI key:InChIKey=JVKOMXUTXGBJFC-ONEGZZNKSA-N
SMILES:C(=C/C(OCC)=O)\C=1C=CSC1
Synonyms:- Ethyl (2E)-3-(3-thienyl)-2-propenoate
- Ethyl (E)-3-(3-thienyl)-2-propenoate
- (E)-Ethyl 3-(thien-3-yl)acrylate
- 2-Propenoic acid, 3-(3-thienyl)-, ethyl ester, (2E)-
- 2-Propenoic acid, 3-(3-thienyl)-, ethyl ester, (E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
