
CAS 123297-90-5
:5-Hydroxy-2-[(1S)-1-hydroxyethyl]naphtho[2,3-b]furan-4,9-dione
Description:
5-Hydroxy-2-[(1S)-1-hydroxyethyl]naphtho[2,3-b]furan-4,9-dione, with the CAS number 123297-90-5, is a chemical compound that belongs to the class of naphthoquinones. This substance features a naphthalene core fused with a furan ring and contains multiple functional groups, including hydroxyl and carbonyl groups, which contribute to its reactivity and potential biological activity. The presence of the hydroxyethyl group suggests that it may exhibit specific stereochemical properties, particularly due to the (1S) configuration. This compound is of interest in various fields, including medicinal chemistry and natural product research, due to its potential pharmacological properties. Its structural characteristics may influence its solubility, stability, and interaction with biological targets. Additionally, compounds of this type are often studied for their antioxidant properties and potential therapeutic applications. However, detailed studies on its specific biological activities and mechanisms of action would be necessary to fully understand its potential uses.
Formula:C14H10O5
InChI:InChI=1S/C14H10O5/c1-6(15)10-5-8-12(17)11-7(3-2-4-9(11)16)13(18)14(8)19-10/h2-6,15-16H,1H3/t6-/m0/s1
InChI key:InChIKey=XJGFVZBTNKODFQ-LURJTMIESA-N
SMILES:O=C1C2=C(C(=O)C=3C1=CC=CC3O)C=C([C@H](C)O)O2
Synonyms:- Naphtho[2,3-b]furan-4,9-dione, 5-hydroxy-2-(1-hydroxyethyl)-, (S)-
- Naphtho[2,3-b]furan-4,9-dione, 5-hydroxy-2-[(1S)-1-hydroxyethyl]-
- 5-Hydroxy-2-[(1S)-1-hydroxyethyl]naphtho[2,3-b]furan-4,9-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
STAT3-IN-14
CAS:STAT3-IN-14 is a STAT3 inhibitor and has STAT3 phosphorylation inhibitory activity. STAT3-IN-14 can directly bind to the hinge region of STAT3 .Formula:C14H10O5Color and Shape:SolidMolecular weight:258.23
