CymitQuimica logo

CAS 1233026-11-3

:

3-Bromo-4-fluoro-5-(trifluoromethyl)aniline

Description:
3-Bromo-4-fluoro-5-(trifluoromethyl)aniline is an aromatic amine characterized by the presence of multiple halogen substituents on its benzene ring. Specifically, it features a bromine atom at the 3-position, a fluorine atom at the 4-position, and a trifluoromethyl group (-CF3) at the 5-position, which significantly influences its chemical properties. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents due to its polar functional groups. The presence of the trifluoromethyl group enhances its lipophilicity and can affect its reactivity, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, the halogen substituents can impart unique electronic properties, influencing the compound's reactivity in electrophilic aromatic substitution reactions. Safety considerations are important when handling this compound, as halogenated amines can pose health risks, and appropriate precautions should be taken to minimize exposure. Overall, 3-Bromo-4-fluoro-5-(trifluoromethyl)aniline is a notable compound in organic synthesis and materials science.
Formula:C7H4BrF4N
InChI:InChI=1S/C7H4BrF4N/c8-5-2-3(13)1-4(6(5)9)7(10,11)12/h1-2H,13H2
InChI key:FNWBXSBUORVUQH-UHFFFAOYSA-N
SMILES:C1=C(C=C(C(=C1C(F)(F)F)F)Br)N
Found 4 products.