CAS 1233026-30-6

6-[4-[[(1,1-Dimethylethoxy)carbonyl]amino]-1-piperidinyl]-5-methyl-2-pyridinecarboxylic acid

Description:

6-[4-[[(1,1-Dimethylethoxy)carbonyl]amino]-1-piperidinyl]-5-methyl-2-pyridinecarboxylic acid, with CAS number 1233026-30-6, is a chemical compound characterized by its complex structure, which includes a pyridine ring, a piperidine moiety, and a dimethylethoxycarbonyl group. This compound typically exhibits properties associated with both acidic and basic functional groups, allowing it to participate in various chemical reactions, including amide formation and nucleophilic substitutions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The presence of the piperidine ring may contribute to its pharmacological activity, while the carboxylic acid group can influence solubility and reactivity. Additionally, the dimethylethoxycarbonyl group may enhance stability and bioavailability. Overall, this compound's unique characteristics make it a subject of interest for further research in drug development and synthetic chemistry.

Formula: C₁₇H₂₅N₃O₄

InChI: InChI=1S/C17H25N3O4/c1-11-5-6-13(15(21)22)19-14(11)20-9-7-12(8-10-20)18-16(23)24-17(2,3)4/h5-6,12H,7-10H2,1-4H3,(H,18,23)(H,21,22)

InChI key: InChIKey=YHVVYVUMGPTCGW-UHFFFAOYSA-N

SMILES: CC1=C(N=C(C(O)=O)C=C1)N2CCC(NC(OC(C)(C)C)=O)CC2

Synonyms:

• 2-Pyridinecarboxylic acid, 6-[4-[[(1,1-dimethylethoxy)carbonyl]amino]-1-piperidinyl]-5-methyl-
• 6-[4-[[(1,1-Dimethylethoxy)carbonyl]amino]-1-piperidinyl]-5-methyl-2-pyridinecarboxylic acid