CymitQuimica logo

CAS 1233026-72-6

:

4-(4-Phenoxy-5-pyrimidinyl)benzaldehyde

Description:
4-(4-Phenoxy-5-pyrimidinyl)benzaldehyde is an organic compound characterized by its complex structure, which includes a benzaldehyde functional group and a pyrimidine ring substituted with a phenoxy group. This compound typically exhibits properties associated with aromatic aldehydes, such as a distinct aromatic odor and potential reactivity in electrophilic substitution reactions. The presence of the pyrimidine moiety suggests potential biological activity, as pyrimidine derivatives are often found in pharmaceuticals and agrochemicals. The compound may also display solubility in organic solvents, while its solubility in water is generally limited due to its hydrophobic aromatic components. Additionally, it may participate in various chemical reactions, including condensation and oxidation, making it a valuable intermediate in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 4-(4-Phenoxy-5-pyrimidinyl)benzaldehyde is of interest for its potential applications in medicinal chemistry and material science.
Formula:C17H12N2O2
InChI:InChI=1S/C17H12N2O2/c20-11-13-6-8-14(9-7-13)16-10-18-12-19-17(16)21-15-4-2-1-3-5-15/h1-12H
InChI key:InChIKey=LPYFAHVUUJQVHO-UHFFFAOYSA-N
SMILES:O(C=1C(=CN=CN1)C2=CC=C(C=O)C=C2)C3=CC=CC=C3
Synonyms:
  • Benzaldehyde, 4-(4-phenoxy-5-pyrimidinyl)-
  • 4-(4-Phenoxy-5-pyrimidinyl)benzaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.