CAS 1233055-24-7

3-(4-Bromo-2-chlorophenyl)-2-propenoic acid

Description:

3-(4-Bromo-2-chlorophenyl)-2-propenoic acid is an organic compound characterized by its unique structure, which includes a propenoic acid moiety and a substituted phenyl group. The presence of both bromine and chlorine atoms on the phenyl ring contributes to its reactivity and potential applications in various chemical reactions, including electrophilic aromatic substitution. This compound typically exhibits properties associated with unsaturated carboxylic acids, such as acidity due to the carboxyl functional group, and it may participate in polymerization reactions due to the double bond in the propenoic acid structure. Its halogen substituents can influence its solubility, stability, and interaction with biological systems, making it of interest in medicinal chemistry and material science. Additionally, the compound's molecular characteristics may allow it to act as a precursor in the synthesis of more complex organic molecules. Safety and handling precautions should be observed due to the presence of halogens, which can pose health risks.

Formula: C₉H₆BrClO₂

InChI: InChI=1S/C9H6BrClO2/c10-7-3-1-6(8(11)5-7)2-4-9(12)13/h1-5H,(H,12,13)

InChI key: InChIKey=IQASDWBWCLYMJB-UHFFFAOYSA-N

SMILES: C(=CC(O)=O)C1=C(Cl)C=C(Br)C=C1

Synonyms:

• 2-Propenoic acid, 3-(4-bromo-2-chlorophenyl)-
• 3-(4-Bromo-2-chlorophenyl)-2-propenoic acid
• 4-Bromo-2-chlorocinnamic acid

2-Propenoic acid, 3-(4-bromo-2-chlorophenyl)-

CAS: 1233055-24-7

Formula: C₉H₆BrClO₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 261.4997

Ref: IN-DA000KAJ

3-(4-Bromo-2-chlorophenyl)acrylic acid

CAS: 1233055-24-7

3-(4-Bromo-2-chlorophenyl)acrylic acid

Purity: 96%

Molecular weight: 261.5g/mol

Ref: 54-OR1006349

4-Bromo-2-chlorocinnamic acid

CAS: 1233055-24-7

4-Bromo-2-chlorocinnamic acid is a useful chemical in the synthesis of organic compounds. It is an intermediate in the production of pharmaceuticals and other organic compounds. The compound has been used as a research chemical and as a building block for the production of complex chemicals. 4-Bromo-2-chlorocinnamic acid has also been used as a building block for the production of fine chemicals, such as dyes, perfumes, and pesticides.

Formula: C₉H₆BrClO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 261.5 g/mol

Ref: 3D-FB70087

4-BROMO-2-CHLOROCINNAMIC ACID

CAS: 1233055-24-7

Purity: 96%

Molecular weight: 261.5

Ref: 10-F794429