CAS 123308-28-1

4,5,6,7-tetrahydrotriazolo[1,5-a]pyrazine hydrochloride

Description:

4,5,6,7-Tetrahydrotriazolo[1,5-a]pyrazine hydrochloride is a chemical compound characterized by its bicyclic structure, which includes a triazole and a pyrazine moiety. This compound is typically a white to off-white crystalline solid, soluble in water and various organic solvents, which makes it useful in pharmaceutical applications. The presence of the hydrochloride salt form enhances its solubility and stability. It is known for its potential biological activities, including effects on the central nervous system, and may serve as a scaffold for the development of novel therapeutic agents. The compound's molecular structure contributes to its reactivity and interaction with biological targets, making it of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper laboratory practices. Overall, 4,5,6,7-tetrahydrotriazolo[1,5-a]pyrazine hydrochloride represents a unique class of compounds with potential applications in drug discovery and development.

Formula: C₅H₉ClN₄

InChI: InChI=1/C5H8N4.ClH/c1-2-9-5(3-6-1)4-7-8-9;/h4,6H,1-3H2;1H

SMILES: C1Cn2c(CN1)cnn2.Cl

[1,2,3]Triazolo[1,5-a]pyrazine, 4,5,6,7-tetrahydro-, hydrochloride (1:1)

CAS: 123308-28-1

Formula: C₅H₉ClN₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 160.6048

Ref: IN-DA000KBU

4,5,6,7-Tetrahydro-[1,2,3]triazolo[1,5-a]pyrazine hydrochloride

CAS: 123308-28-1

Purity: 95.0%

Molecular weight: 160.61000061035156

Ref: 10-F321344

4,5,6,7-Tetrahydro-[1,2,3]triazolo[1,5-a]pyrazine hydrochloride

CAS: 123308-28-1

Versatile small molecule scaffold

Formula: C₅H₉ClN₄

Purity: Min. 95%

Molecular weight: 160.6 g/mol

Ref: 3D-YEA30828