CymitQuimica logo

CAS 1233143-48-0

:

2-Thia-6-azaspiro[3.3]heptane hemioxalate

Description:
2-Thia-6-azaspiro[3.3]heptane hemioxalate is a chemical compound characterized by its unique spirocyclic structure, which incorporates both sulfur and nitrogen atoms within a seven-membered ring system. The presence of the thia (sulfur) and aza (nitrogen) functionalities contributes to its potential reactivity and interaction with biological systems. This compound is typically classified as a heterocyclic compound due to the inclusion of different elements in its ring structure. The hemioxalate form indicates that it is a salt or ester derived from oxalic acid, which may influence its solubility and stability in various solvents. Such compounds often exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The specific arrangement of atoms and functional groups can lead to diverse applications, including potential use in drug development or as intermediates in organic synthesis. However, detailed studies on its physical properties, reactivity, and biological activity would be necessary to fully understand its characteristics and potential applications.
Formula:C12H20N2O4S2
InChI:InChI=1S/2C5H9NS.C2H2O4/c2*1-5(2-6-1)3-7-4-5;3-1(4)2(5)6/h2*6H,1-4H2;(H,3,4)(H,5,6)
InChI key:IUOHIXFWUIKFFT-UHFFFAOYSA-N
SMILES:C1C2(CN1)CSC2.C1C2(CN1)CSC2.C(=O)(C(=O)O)O
Found 4 products.