CAS 123320-59-2
:2-(1-Methylethyl)-1-(4-nitrophenyl)-1H-imidazole
Description:
2-(1-Methylethyl)-1-(4-nitrophenyl)-1H-imidazole, with the CAS number 123320-59-2, is a chemical compound characterized by its imidazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features a 4-nitrophenyl group, which contributes to its electronic properties and potential reactivity, as well as a branched alkyl substituent (1-methylethyl) that can influence its solubility and steric hindrance. The presence of the nitro group typically enhances the compound's polarity and can affect its interaction with biological systems, making it of interest in medicinal chemistry. The imidazole moiety is known for its role in various biological processes and can act as a ligand in coordination chemistry. Overall, this compound may exhibit interesting pharmacological properties, and its structural features suggest potential applications in drug development or as a biochemical probe. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C12H13N3O2
InChI:InChI=1S/C12H13N3O2/c1-9(2)12-13-7-8-14(12)10-3-5-11(6-4-10)15(16)17/h3-9H,1-2H3
InChI key:InChIKey=HPXFONXFOUFRTP-UHFFFAOYSA-N
SMILES:C(C)(C)C=1N(C=CN1)C2=CC=C(N(=O)=O)C=C2
Synonyms:- 2-(1-Methylethyl)-1-(4-nitrophenyl)-1H-imidazole
- 1-(4-Nitrophenyl)-2-propan-2-ylimidazole
- 2-Isopropyl-1-(4-nitrophenyl)-1H-imidazole
- 1H-Imidazole, 2-(1-methylethyl)-1-(4-nitrophenyl)-
- 1-(4-Nitrophenyl)-2-(propan-2-yl)-1H-imidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.