
CAS 1233200-52-6
:2-(9,9′-Spirobi[9H-fluoren]-2-yl)-4,6-bis([1,1′:3′,1′′-terphenyl]-5′-yl)-1,3,5-triazine
Description:
The chemical substance known as 2-(9,9′-Spirobi[9H-fluoren]-2-yl)-4,6-bis([1,1′:3′,1′′-terphenyl]-5′-yl)-1,3,5-triazine is a complex organic compound characterized by its unique molecular structure, which includes a triazine core and multiple aromatic substituents. This compound features a spirobifluorene moiety, contributing to its rigidity and potential for strong π-π stacking interactions. The presence of terphenyl groups enhances its electronic properties, making it of interest in optoelectronic applications, such as organic light-emitting diodes (OLEDs) and organic photovoltaics (OPVs). Its synthesis typically involves multi-step organic reactions, and it may exhibit notable thermal stability and photophysical properties. Additionally, the compound's solubility and crystallinity can vary based on the substituents, influencing its practical applications in materials science. Overall, this substance represents a significant area of research in the development of advanced organic materials for electronic applications.
Formula:C64H41N3
InChI:InChI=1S/C64H41N3/c1-5-19-42(20-6-1)47-35-48(43-21-7-2-8-22-43)38-51(37-47)62-65-61(66-63(67-62)52-39-49(44-23-9-3-10-24-44)36-50(40-52)45-25-11-4-12-26-45)46-33-34-56-55-29-15-18-32-59(55)64(60(56)41-46)57-30-16-13-27-53(57)54-28-14-17-31-58(54)64/h1-41H
InChI key:InChIKey=LXCFSFDAHQLFAC-UHFFFAOYSA-N
SMILES:C12(C=3C(C=4C1=CC=CC4)=CC=C(C3)C=5N=C(N=C(N5)C6=CC(=CC(=C6)C7=CC=CC=C7)C8=CC=CC=C8)C9=CC(=CC(=C9)C%10=CC=CC=C%10)C%11=CC=CC=C%11)C=%12C(C=%13C2=CC=CC%13)=CC=CC%12
Synonyms:- 2-(9,9′-Spirobi[9H-fluoren]-2-yl)-4,6-bis([1,1′:3′,1′′-terphenyl]-5′-yl)-1,3,5-triazine
- 1,3,5-Triazine, 2-(9,9′-spirobi[9H-fluoren]-2-yl)-4,6-bis([1,1′:3′,1′′-terphenyl]-5′-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(9,9′-Spirobi[9H-fluoren]-2-yl)-4,6-bis([1,1′:3′,1′′-terphenyl]-5′-yl)-1,3,5-triazine
CAS:Formula:C64H41N3Molecular weight:852.0304
