CAS 1233200-59-3

B-(5′-Phenyl[1,1′:3′,1′′-terphenyl]-3-yl)boronic acid

Description:

B-(5′-Phenyl[1,1′:3′,1′′-terphenyl]-3-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and materials science. The compound features a complex terphenyl structure, which contributes to its unique electronic and steric properties. Typically, boronic acids are utilized in Suzuki coupling reactions, facilitating the formation of carbon-carbon bonds, and can also serve as ligands in coordination chemistry. The presence of the phenyl groups enhances the compound's stability and solubility in organic solvents. Additionally, boronic acids can exhibit pH-dependent behavior, influencing their reactivity and interactions in biological systems. Overall, B-(5′-Phenyl[1,1′:3′,1′′-terphenyl]-3-yl)boronic acid is a versatile compound with significant implications in synthetic organic chemistry and potential applications in drug development and materials engineering.

Formula: C₂₄H₁₉BO₂

InChI: InChI=1S/C24H19BO2/c26-25(27)24-13-7-12-20(17-24)23-15-21(18-8-3-1-4-9-18)14-22(16-23)19-10-5-2-6-11-19/h1-17,26-27H

InChI key: InChIKey=PMJINXYVWUMEEV-UHFFFAOYSA-N

SMILES: B(O)(O)C=1C=C(C2=CC(=CC(=C2)C3=CC=CC=C3)C4=CC=CC=C4)C=CC1

Synonyms:

• B-(5′-Phenyl[1,1′:3′,1′′-terphenyl]-3-yl)boronic acid
• (3′,5′-Diphenyl-[1,1′-biphenyl]-3-yl)boronic acid
• Boronic acid, B-(5′-phenyl[1,1′:3′,1′′-terphenyl]-3-yl)-

Boronic acid, B-(5′-phenyl[1,1′:3′,1′′-terphenyl]-3-yl)-

CAS: 1233200-59-3

Formula: C₂₄H₁₉BO₂

Purity: 98%

Molecular weight: 350.2175

Ref: IN-DA01S78L

(5'-Phenyl-[1,1':3',1''-terphenyl]-3-yl)boronic acid

CAS: 1233200-59-3

(5'-Phenyl-[1,1':3',1''-terphenyl]-3-yl)boronic acid

Purity: 98%

Molecular weight: 350.23g/mol

Ref: 54-OR1063913