CymitQuimica logo

CAS 123330-91-6

:

TERT-BUTYL 3-METHOXY-4-NITROBENZOATE

Description:
Tert-Butyl 3-methoxy-4-nitrobenzoate, with the CAS number 123330-91-6, is an organic compound characterized by its ester functional group. It features a tert-butyl group, which contributes to its hydrophobic properties, and a methoxy group that enhances its solubility in organic solvents. The presence of the nitro group at the para position of the aromatic ring introduces electron-withdrawing characteristics, influencing the compound's reactivity and stability. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure suggests it may exhibit moderate polarity, allowing for interactions in various chemical environments. Additionally, the compound's stability under standard conditions makes it suitable for various applications in research and industry. Safety data should be consulted for handling, as nitro compounds can be sensitive to heat and shock. Overall, tert-butyl 3-methoxy-4-nitrobenzoate is a versatile compound with significant implications in synthetic organic chemistry.
Formula:C12H15NO5
InChI:InChI=1S/C12H15NO5/c1-12(2,3)18-11(14)8-5-6-9(13(15)16)10(7-8)17-4/h5-7H,1-4H3
InChI key:LFDOPLFGPFOCKH-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)C1=CC(=C(C=C1)[N+](=O)[O-])OC
Found 2 products.