CymitQuimica logo

CAS 123333-58-4

:

Benzenesulfonic acid, 3-[2-pyridinyl[2-(2-pyridinyl)hydrazinylidene]methyl]-, hydrate (1:2)

Description:
Benzenesulfonic acid, 3-[2-pyridinyl[2-(2-pyridinyl)hydrazinylidene]methyl]-, hydrate (1:2) is a complex organic compound characterized by its sulfonic acid functional group, which contributes to its acidic properties and solubility in water. The presence of multiple pyridine rings indicates potential for coordination chemistry and biological activity, as pyridine derivatives are often involved in various biochemical processes. The hydrazine moiety suggests reactivity, particularly in forming hydrazones or undergoing oxidation reactions. As a hydrate, it contains water molecules in its structure, which can influence its stability and solubility. This compound may exhibit properties such as antimicrobial or antitumor activity, common among similar heterocyclic compounds. Its molecular structure allows for potential applications in pharmaceuticals, agrochemicals, or as a reagent in organic synthesis. However, specific safety and handling guidelines should be followed due to the potential hazards associated with sulfonic acids and hydrazines.
Formula:C17H14N4O3S·2H2O
InChI:InChI=1S/C17H14N4O3S.2H2O/c22-25(23,24)14-7-5-6-13(12-14)17(15-8-1-3-10-18-15)21-20-16-9-2-4-11-19-16;;/h1-12H,(H,19,20)(H,22,23,24);2*1H2
InChI key:InChIKey=GINQVBKQORLPJU-UHFFFAOYSA-N
SMILES:C(=NNC1=CC=CC=N1)(C2=CC(S(=O)(=O)O)=CC=C2)C3=CC=CC=N3.O
Synonyms:
  • Benzenesulfonic acid, 3-[2-pyridinyl(2-pyridinylhydrazono)methyl]-, dihydrate
  • Benzenesulfonic acid, 3-[2-pyridinyl[2-(2-pyridinyl)hydrazinylidene]methyl]-, hydrate (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.