CAS 123333-68-6
:2-sulfobenzoic acid hydrate
Description:
2-Sulfobenzoic acid hydrate, identified by the CAS number 123333-68-6, is a chemical compound that features a sulfonic acid group (-SO3H) attached to a benzoic acid structure. This compound typically exists as a hydrate, indicating the presence of water molecules associated with its crystalline form. The sulfonic acid group imparts strong acidic properties, making it more soluble in water compared to its non-sulfonated counterparts. The presence of the sulfonic group also enhances its reactivity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. In terms of physical properties, 2-sulfobenzoic acid hydrate is usually a white to off-white crystalline solid. It is used in various applications, including as a reagent in organic synthesis and in the production of dyes and pharmaceuticals. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C7H8O6S
InChI:InChI=1/C7H6O5S.H2O/c8-7(9)5-3-1-2-4-6(5)13(10,11)12;/h1-4H,(H,8,9)(H,10,11,12);1H2
SMILES:c1ccc(c(c1)C(=O)O)S(=O)(=O)O.O
Synonyms:- Benzoic acid, 2-sulfo-, hydrate (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Sulfobenzoic acid hydrate, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C7H6O5SPurity:98%Color and Shape:Crystals or crystalline powder, White to pale cream or pale greyMolecular weight:202.182-Sulfobenzoic acid trihydrate
CAS:Formula:C7H8O6SPurity:98%Color and Shape:SolidMolecular weight:220.1998

