CAS 123333-71-1
:DL-Histidine monohydrochloride monohydrate
Description:
DL-Histidine monohydrochloride monohydrate is a salt form of the amino acid histidine, which is essential for various biological functions. It is characterized by its white crystalline appearance and is highly soluble in water, making it suitable for various biochemical applications. The compound is a zwitterion, possessing both positive and negative charges, which contributes to its solubility and reactivity. As a monohydrochloride, it contains one hydrochloride ion per histidine molecule, enhancing its stability and solubility in aqueous solutions. The monohydrate form indicates the presence of one water molecule per molecule of the compound, which can influence its handling and storage conditions. DL-Histidine is often used in cell culture media, nutritional supplements, and pharmaceutical formulations due to its role in protein synthesis and as a precursor for histamine. Additionally, it may exhibit antioxidant properties and is involved in various metabolic processes. Proper storage in a cool, dry place is recommended to maintain its stability and efficacy.
Formula:C6H12ClN3O3
InChI:InChI=1/C6H9N3O2.ClH.H2O/c7-5(6(10)11)1-4-2-8-3-9-4;;/h2-3,5H,1,7H2,(H,8,9)(H,10,11);1H;1H2
SMILES:C(c1cnc[nH]1)C(C(=O)O)N.Cl.O
Synonyms:- Histidinemonohydrochloridemonohydrate
- Histidine Hydrochloride Hydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
DL-Histidine monohydrochloride monohydrate, 99%
CAS:DL-Histidine monohydrochloride monohydrate is the mixed isomer of D- and L-histidine. It may be used to evaluate the efficiency of amino acid chiral ligand exchange media and systems and in running buffers for capillary electrophoresis. It is also an important organic intermediate. It can be used inFormula:C6H12ClN3O3Purity:99%Color and Shape:White to pale cream, Crystals or powder or crystalline powderMolecular weight:209.63Dl-histidine monohydrochloride
CAS:Formula:C6H12ClN3O3Purity:97%Color and Shape:SolidMolecular weight:209.6308DL-Histidine Monohydrochloride Monohydrate
CAS:DL-Histidine Monohydrochloride MonohydratePurity:98%Molecular weight:209.63g/molDL-Histidine monohydrochloride monohydrate
CAS:Formula:C6H9N3O2·HCl·H2OPurity:≥ 98.0%Color and Shape:White to off-white crystalline powderMolecular weight:209.632-Amino-3-(1H-imidazol-4-yl)propanoic acid hydrochloride
CAS:Formula:C6H10ClN3O2Purity:98%Molecular weight:191.62




