CAS 123333-75-5

β-D-Fructofuranose, 2,6-bis(dihydrogen phosphate), sodium salt, hydrate

Description:

β-D-Fructofuranose, 2,6-bis(dihydrogen phosphate), sodium salt, hydrate is a phosphorylated derivative of fructose, a simple sugar that plays a crucial role in carbohydrate metabolism. This compound features two phosphate groups attached to the 2 and 6 positions of the fructofuranose ring, which enhances its solubility and reactivity in biological systems. The sodium salt form indicates that sodium ions are associated with the phosphate groups, contributing to its ionic nature and potential applications in biochemical processes. As a hydrate, it contains water molecules in its crystalline structure, which can influence its stability and solubility. This compound is often studied for its role in metabolic pathways and its potential applications in food science and biochemistry, particularly in relation to energy metabolism and as a phosphate donor in enzymatic reactions. Its unique structure allows it to participate in various biochemical interactions, making it a subject of interest in research related to sugars and phosphates.

Formula: C₆H₁₄O₁₂P₂·xH₂O·xNa

InChI: InChI=1S/C6H14O12P2.Na.H2O/c7-2-6(18-20(13,14)15)5(9)4(8)3(17-6)1-16-19(10,11)12;;/h3-5,7-9H,1-2H2,(H2,10,11,12)(H2,13,14,15);;1H2/t3-,4-,5+,6+;;/m1../s1

InChI key: InChIKey=IUYLKGWWIDOKOT-WMUOJARJSA-N

SMILES: O(P(=O)(O)O)[C@@]1(CO)[C@@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O1.[Na].O

Synonyms:

• β-D-Fructofuranose, 2,6-bis(dihydrogen phosphate), sodium salt, hydrate