CAS 123333-86-8

Toluene-3,4-dithiol zinc salt hydrate

Description:

Toluene-3,4-dithiol zinc salt hydrate, identified by its CAS number 123333-86-8, is a coordination compound that features toluene-3,4-dithiol as the ligand coordinated to zinc ions. This compound typically exhibits properties characteristic of both organic and inorganic materials. The presence of the dithiol functional groups allows for the formation of chelate complexes with zinc, enhancing its stability and solubility in various solvents. As a hydrate, it contains water molecules in its crystalline structure, which can influence its physical properties, such as melting point and solubility. The compound may exhibit moderate toxicity, necessitating careful handling in laboratory settings. Its applications can span across fields such as materials science, catalysis, and potentially in biological systems, where it may interact with metal ions or serve as a precursor for other chemical syntheses. Overall, Toluene-3,4-dithiol zinc salt hydrate is a versatile compound with unique characteristics stemming from its molecular structure and coordination chemistry.

Formula: C₇H₈OS₂Zn

InChI: InChI=1/C7H8S2.H2O.Zn/c1-5-2-3-6(8)7(9)4-5;;/h2-4,8-9H,1H3;1H2;/q;;+2/p-2/rC7H6S2Zn.H2O/c1-5-2-3-6-7(4-5)9-10-8-6;/h2-4H,1H3;1H2

SMILES: Cc1ccc(c(c1)S)S.O.[Zn]

Synonyms:

• (3,4-Toluenedithiolato(2-))Zinc Hydrate