CAS 1233332-93-8

N-[[3′-[[1-(4-Chloro-3-methylphenyl)-1-methylethyl]amino]-3,5-dimethyl[1,1′-biphenyl]-4-yl]carbonyl]-L-alanine

Description:

N-[[3′-[[1-(4-Chloro-3-methylphenyl)-1-methylethyl]amino]-3,5-dimethyl[1,1′-biphenyl]-4-yl]carbonyl]-L-alanine, identified by its CAS number 1233332-93-8, is a synthetic organic compound characterized by its complex structure, which includes an amino acid moiety (L-alanine) and a biphenyl derivative. This compound features a chloro-substituted aromatic ring and a branched alkyl chain, contributing to its potential biological activity. The presence of multiple functional groups, such as amine and carbonyl, suggests that it may engage in various chemical interactions, making it of interest in medicinal chemistry and drug development. Its specific properties, such as solubility, stability, and reactivity, would depend on the molecular environment and conditions. Additionally, the compound's potential applications could range from therapeutic uses to serving as a building block in the synthesis of more complex molecules. However, detailed studies would be necessary to fully elucidate its characteristics and biological effects.

Formula: C₂₈H₃₁ClN₂O₃

InChI: InChI=1S/C28H31ClN2O3/c1-16-14-22(10-11-24(16)29)28(5,6)31-23-9-7-8-20(15-23)21-12-17(2)25(18(3)13-21)26(32)30-19(4)27(33)34/h7-15,19,31H,1-6H3,(H,30,32)(H,33,34)/t19-/m0/s1

InChI key: InChIKey=CCIFGUCMXJOUDB-IBGZPJMESA-N

SMILES: CC=1C=C(C=C(C)C1C(N[C@H](C(O)=O)C)=O)C2=CC(NC(C)(C)C3=CC(C)=C(Cl)C=C3)=CC=C2

Synonyms:

• N-[[3′-[[1-(4-Chloro-3-methylphenyl)-1-methylethyl]amino]-3,5-dimethyl[1,1′-biphenyl]-4-yl]carbonyl]-L-alanine
• L-Alanine, N-[[3′-[[1-(4-chloro-3-methylphenyl)-1-methylethyl]amino]-3,5-dimethyl[1,1′-biphenyl]-4-yl]carbonyl]-

Ex 82

CAS: 1233332-93-8

Sphingosine-1-phosphate receptor 1 (S1P1) inhibitor

Formula: C₂₈H₃₁ClN₂O₃

Purity: Min. 95%

Molecular weight: 479.01 g/mol

Ref: 3D-BE170832