CAS 123334-29-2
:Cobalt(II)2,4-pentanedionate
Description:
Cobalt(II) 2,4-pentanedionate, also known as cobalt(II) acetylacetonate, is a coordination compound characterized by its cobalt center coordinated to two 2,4-pentanedionate ligands. This compound typically appears as a blue or violet solid and is soluble in organic solvents such as ethanol and acetone, but less soluble in water. It exhibits a square planar or octahedral geometry depending on the coordination environment. Cobalt(II) 2,4-pentanedionate is often used as a catalyst in various chemical reactions, including polymerization and oxidation processes, due to its ability to facilitate electron transfer. Additionally, it has applications in the preparation of cobalt-based materials and as a precursor in the synthesis of cobalt oxide nanoparticles. The compound is also of interest in the field of coordination chemistry and materials science. Safety precautions should be taken when handling this substance, as cobalt compounds can pose health risks, including potential toxicity and environmental hazards.
Formula:C5H9CoO3
InChI:InChI=1/C5H8O2.Co.H2O/c1-4(6)3-5(2)7;;/h3,6H,1-2H3;;1H2/q;+2;/p-1/b4-3-;;
Synonyms:- Cobalt(II) acetylacetonate hydrate
- Cobaltacetylacetonatehydratepinkpowder
- Bis(acetylacetonato)cobalt(II) hydrate~Bis(2,4-pentanedionato)cobalt(II) hydrate~Cobalt(II) 2,4-pentanedionate hydrate
- 2-penten-2-olate, 4-oxo-, (2Z)-, cobalt(2+) salt, hydrate (1:1:1)
- Cobalt acetylacetonate hydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Bis(2,4-pentanedionato)cobalt(II) Dihydrate
CAS:Formula:C10H14CoO4·2H2OPurity:>98.0%(T)Color and Shape:Light yellow to Brown powder to crystalMolecular weight:293.18COBALT(II) ACETYLACETONATE
CAS:Formula:C10H18CoO5Purity:95%Color and Shape:SolidMolecular weight:277.1801Bis(2,4-pentanedionato)cobalt(II) Dihydrate
CAS:Bis(2,4-pentanedionato)cobalt(II) DihydratePurity:99%Molecular weight:293.18g/mol



