CAS 123344-02-5

2,4-difluoro-5-nitroaniline

Description:

2,4-Difluoro-5-nitroaniline is an organic compound characterized by the presence of two fluorine atoms and a nitro group attached to an aniline structure. It features a benzene ring with an amino group (-NH2) and is classified as a substituted aniline. The fluorine atoms are located at the 2 and 4 positions, while the nitro group is at the 5 position, contributing to its reactivity and potential applications in various chemical processes. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique electronic properties, influenced by the electronegative fluorine and nitro groups, can affect its behavior in chemical reactions, making it of interest in fields such as pharmaceuticals and agrochemicals. Additionally, the presence of the nitro group may impart certain biological activities, which could be explored in medicinal chemistry. Safety data should be consulted, as nitroanilines can pose health risks, and appropriate handling procedures should be followed.

Formula: C₆H₄F₂N₂O₂

InChI: InChI=1/C6H4F2N2O2/c7-3-1-4(8)6(10(11)12)2-5(3)9/h1-2H,9H2

SMILES: c1c(c(cc(c1F)N(=O)=O)N)F

Synonyms:

• 123344-02-5
• 2,4-Difluoro-5-nitrobenzenamine
• Benzenamine, 2,4-difluoro-5-nitro-
• Zr Bf Df Enw

Benzenamine, 2,4-difluoro-5-nitro-

CAS: 123344-02-5

Formula: C₆H₄F₂N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 174.1050

Ref: IN-DA000KF2

2,4-Difluoro-5-nitroaniline

CAS: 123344-02-5

2,4-Difluoro-5-nitroaniline

Purity: 98%

Molecular weight: 174.11g/mol

Ref: 54-PC909005

2,4-Difluoro-5-nitroaniline

CAS: 123344-02-5

Formula: C₆H₄F₂N₂O₂

Purity: 98%

Color and Shape: Solid, Powder

Molecular weight: 174.107

Ref: 10-F019497