CAS 1233506-01-8

Benzenesulfinic acid, 3-chloro-2-methyl-, sodium salt (1:1)

Description:

Benzenesulfinic acid, 3-chloro-2-methyl-, sodium salt (1:1) is an organosulfur compound characterized by the presence of a sulfinic acid functional group attached to a benzene ring, along with a chlorine atom and a methyl group at specific positions on the aromatic ring. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the sodium salt. The sulfinic acid group contributes to its reactivity, making it useful in various chemical reactions, including as a reducing agent or in the synthesis of other organic compounds. The chlorine substituent can influence the compound's reactivity and stability, while the methyl group can affect its steric properties. This compound may find applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₇H₇ClO₂S·Na

InChI: InChI=1S/C7H7ClO2S.Na/c1-5-6(8)3-2-4-7(5)11(9)10;/h2-4H,1H3,(H,9,10);

InChI key: InChIKey=PFQFGGWLCVQHBF-UHFFFAOYSA-N

SMILES: S(=O)(O)C1=C(C)C(Cl)=CC=C1.[Na]

Synonyms:

• Benzenesulfinic acid, 3-chloro-2-methyl-, sodium salt (1:1)