
CAS 1233521-10-2
:4-Ethynyl-2,5-difluorobenzenamine
Description:
4-Ethynyl-2,5-difluorobenzenamine is an organic compound characterized by its unique structure, which includes an ethynyl group and two fluorine substituents on a benzene ring, along with an amine functional group. The presence of the ethynyl group introduces a triple bond, contributing to the compound's reactivity and potential applications in organic synthesis. The difluorobenzene moiety enhances the compound's electronic properties, making it useful in various chemical reactions and potentially in materials science. The amine group can participate in hydrogen bonding, influencing solubility and reactivity. This compound may be of interest in pharmaceutical research and development due to its structural features, which could lead to the discovery of new therapeutic agents. Additionally, the fluorine atoms can impart unique characteristics such as increased lipophilicity and metabolic stability. Overall, 4-Ethynyl-2,5-difluorobenzenamine is a versatile compound with potential applications in various fields of chemistry and materials science.
Formula:C8H5F2N
InChI:InChI=1S/C8H5F2N/c1-2-5-3-7(10)8(11)4-6(5)9/h1,3-4H,11H2
InChI key:InChIKey=GBMBFEDAMSUJLD-UHFFFAOYSA-N
SMILES:C(#C)C1=C(F)C=C(N)C(F)=C1
Synonyms:- Benzenamine, 4-ethynyl-2,5-difluoro-
- 4-Ethynyl-2,5-difluorobenzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.