CAS 1233525-88-6: 1-Ethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
Description:1-Ethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole is a chemical compound characterized by its unique structure, which includes a pyrazole ring and a boron-containing dioxaborolane moiety. The presence of the ethyl group enhances its solubility and reactivity, making it suitable for various applications in organic synthesis and medicinal chemistry. The dioxaborolane group is notable for its ability to participate in boron-mediated reactions, such as Suzuki coupling, which is valuable in the formation of carbon-carbon bonds. This compound may exhibit interesting biological activities due to the pyrazole moiety, which is often associated with pharmacological properties. Additionally, the steric bulk provided by the tetramethyl substituents can influence its reactivity and stability. Overall, this compound represents a versatile building block in synthetic chemistry, with potential implications in drug development and materials science. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined through experimental methods for practical applications.
Formula:C11H19BN2O2
InChI:InChI=1S/C11H19BN2O2/c1-6-14-8-7-9(13-14)12-15-10(2,3)11(4,5)16-12/h7-8H,6H2,1-5H3
InChI key:InChIKey=RPKQFWMLGWLVIU-UHFFFAOYSA-N
SMILES:N1=C(C=CN1CC)B2OC(C)(C)C(O2)(C)C
- Synonyms:
- 1H-Pyrazole, 1-ethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 1-Ethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole
- 1-Ethyl-3-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
- 1-Ethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole

1-Ethyl-3-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-1H-pyrazole
Ref: IN-DA00HH8Q
1g | To inquire | ||
5g | To inquire | ||
100mg | 200.00 € | ||
250mg | 298.00 € | ||
500mg | 556.00 € |

1-ethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1{H}-pyrazole
Ref: 10-F429053
1g | To inquire | ||
5g | To inquire | ||
100mg | To inquire | ||
250mg | To inquire | ||
500mg | To inquire |

1-Ethyl-3-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-1H-pyrazole
Ref: 3D-IZB52588
50mg | 560.00 € | ||
500mg | 1,541.00 € |