CymitQuimica logo

CAS 1233526-40-3

:

α-Methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole-1-propanenitrile

Description:
α-Methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole-1-propanenitrile is a chemical compound characterized by its unique structural features, which include a pyrazole ring and a dioxaborolane moiety. The presence of the nitrile group contributes to its reactivity and potential applications in organic synthesis. This compound is typically used in medicinal chemistry and material science due to its ability to participate in various chemical reactions, including cross-coupling reactions and as a building block for more complex molecules. The tetramethyl dioxaborolane group enhances its stability and solubility in organic solvents, making it suitable for various synthetic applications. Additionally, the α-methyl group can influence the compound's steric and electronic properties, potentially affecting its biological activity and interaction with other molecules. Overall, this compound exemplifies the versatility of boron-containing compounds in modern chemistry, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C13H20BN3O2
InChI:InChI=1S/C13H20BN3O2/c1-10(6-15)8-17-9-11(7-16-17)14-18-12(2,3)13(4,5)19-14/h7,9-10H,8H2,1-5H3
InChI key:InChIKey=WFRQDTKVRDXDPN-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CN(CC(C#N)C)N=C2
Synonyms:
  • 1H-Pyrazole-1-propanenitrile, α-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • α-Methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole-1-propanenitrile
  • 2-Methyl-3-[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl]propanenitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.