
CAS 1233526-53-8
:1-[2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]ethyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
Description:
The chemical substance known as 1-[2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]ethyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, with CAS number 1233526-53-8, is a complex organic compound characterized by its unique structural features. It contains a pyrazole ring, which is a five-membered heterocyclic compound with two adjacent nitrogen atoms. The presence of a dioxaborolane moiety indicates that it has boron-containing functional groups, which are often utilized in organic synthesis and medicinal chemistry for their reactivity and ability to form stable complexes. Additionally, the dimethylsilyl and tert-butyl groups contribute to its hydrophobic properties, potentially influencing its solubility and reactivity in various environments. The compound's intricate structure suggests potential applications in fields such as agrochemicals or pharmaceuticals, where specific reactivity and stability are desired. Overall, this substance exemplifies the complexity and versatility of modern organic compounds, particularly those designed for specialized applications.
Formula:C17H33BN2O3Si
InChI:InChI=1S/C17H33BN2O3Si/c1-15(2,3)24(8,9)21-11-10-20-13-14(12-19-20)18-22-16(4,5)17(6,7)23-18/h12-13H,10-11H2,1-9H3
InChI key:InChIKey=TZRYOLGWTUNCLS-UHFFFAOYSA-N
SMILES:C(CO[Si](C(C)(C)C)(C)C)N1C=C(C=N1)B2OC(C)(C)C(C)(C)O2
Synonyms:- 1-[2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]ethyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
- 1-(2-(tert-Butyldimethylsilyloxy)ethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
- 1H-Pyrazole, 1-[2-[[(1,1-dimethylethyl)dimethylsilyl]oxy]ethyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-[2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]ethyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
CAS:Formula:C17H33BN2O3SiMolecular weight:352.3520
