
CAS 1233531-35-5
:5-Amino-2-cyclopropylphenol
Description:
5-Amino-2-cyclopropylphenol is an organic compound characterized by the presence of an amino group and a cyclopropyl substituent on a phenolic ring. This compound features a cyclopropyl group, which is a three-membered carbon ring, attached to the second position of the phenol, while the amino group is located at the fifth position. The presence of these functional groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the ability of amino and hydroxyl groups to participate in hydrogen bonding and other interactions. The compound may exhibit various biological activities, which can be influenced by its structural features. Additionally, its solubility, stability, and reactivity can be affected by the cyclopropyl group, which may impart unique properties compared to other phenolic compounds. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of 5-Amino-2-cyclopropylphenol would need to be evaluated through appropriate studies.
Formula:C9H11NO
InChI:InChI=1S/C9H11NO/c10-7-3-4-8(6-1-2-6)9(11)5-7/h3-6,11H,1-2,10H2
InChI key:InChIKey=LDYAJWCQHSPKAU-UHFFFAOYSA-N
SMILES:OC1=C(C2CC2)C=CC(N)=C1
Synonyms:- 5-Amino-2-cyclopropylphenol
- Phenol, 5-amino-2-cyclopropyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.