CAS 1233641-93-4

2-Piperazineethanol, 1-[(2-methylphenyl)methyl]-, hydrochloride (1:2)

Description:

2-Piperazineethanol, 1-[(2-methylphenyl)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperazine and ethanol functional groups, along with a substituted aromatic ring. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. It exhibits basic properties due to the piperazine moiety, which can participate in hydrogen bonding and interact with biological systems. The presence of the 2-methylphenyl group may influence its pharmacological activity, potentially affecting its binding affinity to various receptors. This compound is of interest in medicinal chemistry and may be investigated for its potential therapeutic applications, particularly in the fields of neuropharmacology or as a precursor in the synthesis of other bioactive molecules. As with many chemical substances, safety data should be consulted to understand its handling, storage, and potential hazards.

Formula: C₁₄H₂₂N₂O·2ClH

InChI: InChI=1S/C14H22N2O.2ClH/c1-12-4-2-3-5-13(12)11-16-8-7-15-10-14(16)6-9-17;;/h2-5,14-15,17H,6-11H2,1H3;2*1H

InChI key: InChIKey=PMJITVZBRLOOEF-UHFFFAOYSA-N

SMILES: C(N1C(CCO)CNCC1)C2=C(C)C=CC=C2.Cl

Synonyms:

• 2-Piperazineethanol, 1-[(2-methylphenyl)methyl]-, hydrochloride (1:2)