CAS 123366-50-7

1-Ethyl-5-iodo-1H-tetrazole

Description:

1-Ethyl-5-iodo-1H-tetrazole is a heterocyclic compound characterized by its tetrazole ring, which consists of four nitrogen atoms and one carbon atom, contributing to its unique chemical properties. The presence of an ethyl group at the 1-position and an iodine atom at the 5-position enhances its reactivity and solubility in various solvents. This compound is typically used in organic synthesis and may serve as a building block in the development of pharmaceuticals and agrochemicals. Its iodine substituent can facilitate nucleophilic substitution reactions, making it a valuable intermediate in synthetic chemistry. Additionally, the tetrazole moiety is known for its ability to form stable complexes with metal ions, which can be exploited in coordination chemistry. The compound's stability, reactivity, and potential applications in medicinal chemistry make it a subject of interest in research and development. Safety precautions should be observed when handling this compound, as it may pose health risks typical of halogenated organic substances.

Formula: C₃H₅IN₄

InChI: InChI=1S/C3H5IN4/c1-2-8-3(4)5-6-7-8/h2H2,1H3

InChI key: InChIKey=ZEJSYASQYGPZNY-UHFFFAOYSA-N

SMILES: C(C)N1C(I)=NN=N1

Synonyms:

• 1-Ethyl-5-iodo-1H-1,2,3,4-tetrazole
• 1H-Tetrazole, 1-ethyl-5-iodo-
• 1-Ethyl-5-iodo-1H-tetrazole
• 1-Ethyl-5-iodotetrazole

1-ethyl-5-iodo-1H-1,2,3,4-tetrazole

CAS: 123366-50-7

Formula: C₃H₅IN₄

Molecular weight: 224.0031

Ref: IN-DA000KGI