
CAS 1233690-88-4
:3-Iodoimidazo[1,2-b]pyridazine
Description:
3-Iodoimidazo[1,2-b]pyridazine is a heterocyclic compound characterized by its unique fused ring structure, which combines elements of imidazole and pyridazine. This compound features an iodine atom at the 3-position of the imidazo ring, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the imidazole moiety often imparts biological activity, making such compounds of interest in drug discovery and development. The molecular structure typically exhibits a planar configuration, which can influence its interaction with biological targets. Additionally, the iodine substituent can enhance lipophilicity and alter the electronic properties of the molecule, potentially affecting its pharmacokinetics and pharmacodynamics. As a relatively specialized compound, 3-Iodoimidazo[1,2-b]pyridazine may be utilized in various research applications, including studies on enzyme inhibition, receptor binding, or as a scaffold for synthesizing more complex molecules. Its specific properties, such as solubility and stability, would depend on the surrounding conditions and the presence of other functional groups in related derivatives.
Formula:C6H4IN3
InChI:InChI=1S/C6H4IN3/c7-5-4-8-6-2-1-3-9-10(5)6/h1-4H
InChI key:InChIKey=GNIDBSMXPIOXFA-UHFFFAOYSA-N
SMILES:IC=1N2C(C=CC=N2)=NC1
Synonyms:- Imidazo[1,2-b]pyridazine, 3-iodo-
- 3-Iodoimidazo[1,2-b]pyridazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
