CAS 123380-68-7
:(cys(bzl)84-cd4 fragment 81-92
Description:
The chemical substance known as "(cys(bzl)84-cd4 fragment 81-92" with the CAS number "123380-68-7" is a synthetic peptide derived from the CD4 protein, which plays a crucial role in the immune response by acting as a co-receptor for the T-cell receptor. This specific fragment consists of a sequence of amino acids that includes a cysteine residue modified with a benzyl group (cys(bzl)), which can influence its stability and interaction with other molecules. The peptide is typically studied for its potential applications in immunology, particularly in understanding T-cell activation and the mechanisms of HIV infection, as CD4 is the primary receptor for the virus. Its characteristics may include a specific molecular weight, solubility in various solvents, and the ability to form disulfide bonds due to the presence of cysteine. Additionally, the peptide's structure and properties can be influenced by factors such as pH, temperature, and the presence of other ions or molecules in the environment.
Formula:C69H102N14O26S
InChI:InChI=1/C69H102N14O26S/c1-6-35(4)57(83-64(103)46(80-66(105)55(72)36(5)84)30-37-15-17-39(85)18-16-37)68(107)81-48(33-110-32-38-12-8-7-9-13-38)65(104)76-44(22-27-52(91)92)62(101)82-56(34(2)3)67(106)77-43(21-26-51(89)90)61(100)79-47(31-54(95)96)63(102)75-41(19-24-49(71)86)59(98)73-40(14-10-11-29-70)58(97)74-42(20-25-50(87)88)60(99)78-45(69(108)109)23-28-53(93)94/h7-9,12-13,15-18,34-36,40-48,55-57,84-85H,6,10-11,14,19-33,70,72H2,1-5H3,(H2,71,86)(H,73,98)(H,74,97)(H,75,102)(H,76,104)(H,77,106)(H,78,99)(H,79,100)(H,80,105)(H,81,107)(H,82,101)(H,83,103)(H,87,88)(H,89,90)(H,91,92)(H,93,94)(H,95,96)(H,108,109)/t35-,36+,40-,41-,42-,43-,44-,45-,46-,47-,48-,55-,56-,57-/m0/s1
Synonyms:- (Cys(Bzl)84)-CD4 (81-92)
- H-Thr-Tyr-Ile-Cys(Bzl)-Glu-Val-Glu-Asp-Gln-Lys-Glu-Glu-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
(Cys(Bzl)84)-CD4 (81-92)
CAS:The CD4 molecule is a major component of the human immune system. It interacts with other cells, such as T-cells, and plays an important role in the immune response. The CD4 molecule is a glycoprotein that consists of two subunits, (Cys(Bzl)84)-CD4 and (81-92) H-Thr-Tyr-Ile-Cys(Bzl)-Glu-Val-Glu-Asp-Gln-Lys-Glu-. The sequence of this molecule is important for its function, as it has been shown to be essential for binding to HIV particles. This protein may also play a role in regulating the growth of T cells. It was found that the amino acid sequence of CD4 is not conserved among different species. The amino acid sequence specificity in the CD4 molecule is due to the cysteine residues. These residues are able to form disulfide bridges with other cysteFormula:C69H102N14O26SPurity:Min. 95%Molecular weight:1,575.69 g/mol
