CAS 123380-87-0
:Methyl 6-methoxy-1H-indole-3-acetate
Description:
Methyl 6-methoxy-1H-indole-3-acetate is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific compound features a methoxy group (-OCH3) at the 6-position and an acetate group (-COOCH3) at the 3-position of the indole ring. It is typically a white to off-white solid and is soluble in organic solvents such as ethanol and dichloromethane, but less soluble in water. The presence of the methoxy and acetate groups contributes to its chemical reactivity and potential biological activity. Methyl 6-methoxy-1H-indole-3-acetate may be of interest in medicinal chemistry and pharmacology due to its structural similarity to various bioactive indole derivatives. Its synthesis and characterization are important for exploring its potential applications in drug development and other chemical research fields. As with many organic compounds, handling should be done with care, following appropriate safety protocols.
Formula:C12H13NO3
InChI:InChI=1S/C12H13NO3/c1-15-9-3-4-10-8(5-12(14)16-2)7-13-11(10)6-9/h3-4,6-7,13H,5H2,1-2H3
InChI key:InChIKey=KKNFZZBGRBWCJZ-UHFFFAOYSA-N
SMILES:C(C(OC)=O)C=1C=2C(=CC(OC)=CC2)NC1
Synonyms:- 1H-Indole-3-acetic acid, 6-methoxy-, methyl ester
- Methyl 6-methoxy-1H-indole-3-acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
