CAS 1233859-86-3

3-Pyrrolidinamine, 1-(3-nitro-2-pyridinyl)-, hydrochloride (1:1), (3R)-

Description:

3-Pyrrolidinamine, 1-(3-nitro-2-pyridinyl)-, hydrochloride (1:1), (3R)- is a chemical compound characterized by its pyrrolidine and pyridine moieties, which contribute to its biological activity. The presence of a nitro group on the pyridine ring enhances its reactivity and potential pharmacological properties. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various applications, including medicinal chemistry. The (3R)- designation indicates a specific stereochemistry, which can significantly influence the compound's interaction with biological targets, potentially affecting its efficacy and safety profile. This compound may be of interest in research related to neuropharmacology or other therapeutic areas, given the structural features that suggest possible interactions with neurotransmitter systems. However, detailed studies would be necessary to fully elucidate its properties, mechanisms of action, and potential applications in drug development. As with any chemical substance, proper handling and safety precautions are essential due to the potential for biological activity and toxicity.

Formula: C₉H₁₂N₄O₂·ClH

InChI: InChI=1S/C9H12N4O2.ClH/c10-7-3-5-12(6-7)9-8(13(14)15)2-1-4-11-9;/h1-2,4,7H,3,5-6,10H2;1H/t7-;/m1./s1

InChI key: InChIKey=RNPXMCOLNKQQPZ-OGFXRTJISA-N

SMILES: N(=O)(=O)C1=C(N=CC=C1)N2CC[C@@H](N)C2.Cl

Synonyms:

• 3-Pyrrolidinamine, 1-(3-nitro-2-pyridinyl)-, hydrochloride (1:1), (3R)-

(R)-1-(3-Nitropyridin-2-yl)pyrrolidin-3-amine hydrochloride

CAS: 1233859-86-3

Formula: C₉H₁₃ClN₄O₂

Purity: 95.0%

Molecular weight: 244.68

Ref: 10-F063706