CAS 1233860-19-9

1,1-Dimethylethyl N-[(3S)-1-(3-amino-2-pyridinyl)-3-pyrrolidinyl]carbamate

Description:

1,1-Dimethylethyl N-[(3S)-1-(3-amino-2-pyridinyl)-3-pyrrolidinyl]carbamate, identified by its CAS number 1233860-19-9, is a chemical compound characterized by its complex structure, which includes a carbamate functional group and a pyridine ring. This compound is typically classified as a pharmaceutical intermediate or a potential drug candidate due to its bioactive properties. The presence of the dimethyl group contributes to its steric hindrance, which can influence its interaction with biological targets. The pyridine and pyrrolidine moieties suggest potential interactions with neurotransmitter systems, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Safety data, including toxicity and handling precautions, should be reviewed before use, as with any chemical substance. Overall, this compound exemplifies the intricate design often found in drug development, where specific functional groups are tailored to achieve desired pharmacological effects.

Formula: C₁₄H₂₂N₄O₂

InChI: InChI=1S/C14H22N4O2/c1-14(2,3)20-13(19)17-10-6-8-18(9-10)12-11(15)5-4-7-16-12/h4-5,7,10H,6,8-9,15H2,1-3H3,(H,17,19)/t10-/m0/s1

InChI key: InChIKey=NYNCUPCZXWQXQS-JTQLQIEISA-N

SMILES: NC1=C(N2C[C@@H](NC(OC(C)(C)C)=O)CC2)N=CC=C1

Synonyms:

• 1,1-Dimethylethyl N-[(3S)-1-(3-amino-2-pyridinyl)-3-pyrrolidinyl]carbamate
• Carbamic acid, N-[(3S)-1-(3-amino-2-pyridinyl)-3-pyrrolidinyl]-, 1,1-dimethylethyl ester

(S)-tert-Butyl 1-(3-aminopyridin-2-yl)pyrrolidin-3-ylcarbamate

CAS: 1233860-19-9

Formula: C₁₄H₂₂N₄O₂

Purity: 95.0%

Molecular weight: 278.356

Ref: 10-F063728